About 1-(nitromethoxy)butane
1-(nitromethoxy)butane (PubChem CID 123841450) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 1-(nitromethoxy)butane.
Molecular Properties
| Compound Name | 1-(nitromethoxy)butane |
| PubChem CID | 123841450 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 1-(nitromethoxy)butane |
| SMILES | CCCCOC[N+](=O)[O-] |
| InChI | InChI=1S/C5H11NO3/c1-2-3-4-9-5-6(7)8/h2-5H2,1H3 |
| InChIKey | JCHSJARVTCKXGU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(nitromethoxy)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(nitromethoxy)butane?
The IUPAC name of 1-(nitromethoxy)butane (CID 123841450) is 1-(nitromethoxy)butane.
What is the SMILES notation for 1-(nitromethoxy)butane?
The canonical SMILES for 1-(nitromethoxy)butane is CCCCOC[N+](=O)[O-].
What is the InChIKey of 1-(nitromethoxy)butane?
The InChIKey is JCHSJARVTCKXGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c1-2-3-4-9-5-6(7)8/h2-5H2,1H3.
What are the key properties of 1-(nitromethoxy)butane?
1-(nitromethoxy)butane has a molecular weight of 133.15 g/mol, XLogP of 1.04, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(nitromethoxy)butane is sourced from PubChem (CID 123841450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).