About 1-(nitromethoxy)propane
1-(nitromethoxy)propane (PubChem CID 126717739) has the molecular formula C4H9NO3
and a molecular weight of 119.12 g/mol. Its IUPAC name is 1-(nitromethoxy)propane.
Molecular Properties
| Compound Name | 1-(nitromethoxy)propane |
| PubChem CID | 126717739 |
| Molecular Formula | C4H9NO3 |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | 1-(nitromethoxy)propane |
| SMILES | CCCOC[N+](=O)[O-] |
| InChI | InChI=1S/C4H9NO3/c1-2-3-8-4-5(6)7/h2-4H2,1H3 |
| InChIKey | ABAKTAZVJNPBCC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(nitromethoxy)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(nitromethoxy)propane?
The IUPAC name of 1-(nitromethoxy)propane (CID 126717739) is 1-(nitromethoxy)propane.
What is the SMILES notation for 1-(nitromethoxy)propane?
The canonical SMILES for 1-(nitromethoxy)propane is CCCOC[N+](=O)[O-].
What is the InChIKey of 1-(nitromethoxy)propane?
The InChIKey is ABAKTAZVJNPBCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3/c1-2-3-8-4-5(6)7/h2-4H2,1H3.
What are the key properties of 1-(nitromethoxy)propane?
1-(nitromethoxy)propane has a molecular weight of 119.12 g/mol, XLogP of 0.65, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(nitromethoxy)propane is sourced from PubChem (CID 126717739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).