About nitromethoxyazanium
nitromethoxyazanium (PubChem CID 20579199) has the molecular formula CH5N2O3+
and a molecular weight of 93.06 g/mol. Its IUPAC name is nitromethoxyazanium.
Molecular Properties
| Compound Name | nitromethoxyazanium |
| PubChem CID | 20579199 |
| Molecular Formula | CH5N2O3+ |
| Molecular Weight | 93.06 g/mol |
| Exact Mass | 93.03 |
| IUPAC Name | nitromethoxyazanium |
| SMILES | [NH3+]OC[N+](=O)[O-] |
| InChI | InChI=1S/CH5N2O3/c2-6-1-3(4)5/h1H2,2H3/q+1 |
| InChIKey | XKJHYFUAABCWNF-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 93.06 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitromethoxyazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitromethoxyazanium?
The IUPAC name of nitromethoxyazanium (CID 20579199) is nitromethoxyazanium.
What is the SMILES notation for nitromethoxyazanium?
The canonical SMILES for nitromethoxyazanium is [NH3+]OC[N+](=O)[O-].
What is the InChIKey of nitromethoxyazanium?
The InChIKey is XKJHYFUAABCWNF-UHFFFAOYSA-N. The full InChI is InChI=1S/CH5N2O3/c2-6-1-3(4)5/h1H2,2H3/q+1.
What are the key properties of nitromethoxyazanium?
nitromethoxyazanium has a molecular weight of 93.06 g/mol, XLogP of -1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nitromethoxyazanium is sourced from PubChem (CID 20579199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).