About nitromethyl hypofluorite
nitromethyl hypofluorite (PubChem CID 154094120) has the molecular formula CH2FNO3
and a molecular weight of 95.03 g/mol. Its IUPAC name is nitromethyl hypofluorite.
Molecular Properties
| Compound Name | nitromethyl hypofluorite |
| PubChem CID | 154094120 |
| Molecular Formula | CH2FNO3 |
| Molecular Weight | 95.03 g/mol |
| Exact Mass | 95.00 |
| IUPAC Name | nitromethyl hypofluorite |
| SMILES | O=[N+]([O-])COF |
| InChI | InChI=1S/CH2FNO3/c2-6-1-3(4)5/h1H2 |
| InChIKey | XOXYSSUJNFJXOS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.03 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitromethyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitromethyl hypofluorite?
The IUPAC name of nitromethyl hypofluorite (CID 154094120) is nitromethyl hypofluorite.
What is the SMILES notation for nitromethyl hypofluorite?
The canonical SMILES for nitromethyl hypofluorite is O=[N+]([O-])COF.
What is the InChIKey of nitromethyl hypofluorite?
The InChIKey is XOXYSSUJNFJXOS-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2FNO3/c2-6-1-3(4)5/h1H2.
What are the key properties of nitromethyl hypofluorite?
nitromethyl hypofluorite has a molecular weight of 95.03 g/mol, XLogP of 0.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nitromethyl hypofluorite is sourced from PubChem (CID 154094120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).