About nitrosilane;triethoxy(3-propoxypropyl)silane
nitrosilane;triethoxy(3-propoxypropyl)silane (PubChem CID 174872971) has the molecular formula C12H31NO6Si2
and a molecular weight of 341.55 g/mol. Its IUPAC name is nitrosilane;triethoxy(3-propoxypropyl)silane.
Molecular Properties
| Compound Name | nitrosilane;triethoxy(3-propoxypropyl)silane |
| PubChem CID | 174872971 |
| Molecular Formula | C12H31NO6Si2 |
| Molecular Weight | 341.55 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | nitrosilane;triethoxy(3-propoxypropyl)silane |
| SMILES | CCCOCCC[Si](OCC)(OCC)OCC.O=[N+]([O-])[SiH3] |
| InChI | InChI=1S/C12H28O4Si.H3NO2Si/c1-5-10-13-11-9-12-17(14-6-2,15-7-3)16-8-4;2-1(3)4/h5-12H2,1-4H3;4H3 |
| InChIKey | SYNCTBITJVTIBL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.55 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrosilane;triethoxy(3-propoxypropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrosilane;triethoxy(3-propoxypropyl)silane?
The IUPAC name of nitrosilane;triethoxy(3-propoxypropyl)silane (CID 174872971) is nitrosilane;triethoxy(3-propoxypropyl)silane.
What is the SMILES notation for nitrosilane;triethoxy(3-propoxypropyl)silane?
The canonical SMILES for nitrosilane;triethoxy(3-propoxypropyl)silane is CCCOCCC[Si](OCC)(OCC)OCC.O=[N+]([O-])[SiH3].
What is the InChIKey of nitrosilane;triethoxy(3-propoxypropyl)silane?
The InChIKey is SYNCTBITJVTIBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28O4Si.H3NO2Si/c1-5-10-13-11-9-12-17(14-6-2,15-7-3)16-8-4;2-1(3)4/h5-12H2,1-4H3;4H3.
What are the key properties of nitrosilane;triethoxy(3-propoxypropyl)silane?
nitrosilane;triethoxy(3-propoxypropyl)silane has a molecular weight of 341.55 g/mol, XLogP of 1.39, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nitrosilane;triethoxy(3-propoxypropyl)silane is sourced from PubChem (CID 174872971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).