C16H41NO4Si3 — CID 90354545
1-(3-triethoxysilylpropoxy)-N,N-bis(trimethylsilyl)methanamine (PubChem CID 90354545) has the molecular formula C16H41NO4Si3 and a molecular weight of 395.77 g/mol. Its IUPAC name is 1-(3-triethoxysilylpropoxy)-N,N-bis(trimethylsilyl)methanamine.
| Compound Name | 1-(3-triethoxysilylpropoxy)-N,N-bis(trimethylsilyl)methanamine |
|---|---|
| PubChem CID | 90354545 |
| Molecular Formula | C16H41NO4Si3 |
| Molecular Weight | 395.77 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 1-(3-triethoxysilylpropoxy)-N,N-bis(trimethylsilyl)methanamine |
| SMILES | CCO[Si](CCCOCN([Si](C)(C)C)[Si](C)(C)C)(OCC)OCC |
| InChI | InChI=1S/C16H41NO4Si3/c1-10-19-24(20-11-2,21-12-3)15-13-14-18-16-17(22(4,5)6)23(7,8)9/h10-16H2,1-9H3 |
| InChIKey | SRYUFOHGSPJPEC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|