About 2-nitropropan-2-yl dihydrogen phosphate
2-nitropropan-2-yl dihydrogen phosphate (PubChem CID 174596835) has the molecular formula C3H8NO6P
and a molecular weight of 185.07 g/mol. Its IUPAC name is 2-nitropropan-2-yl dihydrogen phosphate.
Molecular Properties
| Compound Name | 2-nitropropan-2-yl dihydrogen phosphate |
| PubChem CID | 174596835 |
| Molecular Formula | C3H8NO6P |
| Molecular Weight | 185.07 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | 2-nitropropan-2-yl dihydrogen phosphate |
| SMILES | CC(C)(OP(=O)(O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C3H8NO6P/c1-3(2,4(5)6)10-11(7,8)9/h1-2H3,(H2,7,8,9) |
| InChIKey | XEKFKKDGPLBHAA-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.07 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-nitropropan-2-yl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitropropan-2-yl dihydrogen phosphate?
The IUPAC name of 2-nitropropan-2-yl dihydrogen phosphate (CID 174596835) is 2-nitropropan-2-yl dihydrogen phosphate.
What is the SMILES notation for 2-nitropropan-2-yl dihydrogen phosphate?
The canonical SMILES for 2-nitropropan-2-yl dihydrogen phosphate is CC(C)(OP(=O)(O)O)[N+](=O)[O-].
What is the InChIKey of 2-nitropropan-2-yl dihydrogen phosphate?
The InChIKey is XEKFKKDGPLBHAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8NO6P/c1-3(2,4(5)6)10-11(7,8)9/h1-2H3,(H2,7,8,9).
What are the key properties of 2-nitropropan-2-yl dihydrogen phosphate?
2-nitropropan-2-yl dihydrogen phosphate has a molecular weight of 185.07 g/mol, XLogP of 0.11, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitropropan-2-yl dihydrogen phosphate is sourced from PubChem (CID 174596835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).