About azane;nitro dihydrogen phosphate
azane;nitro dihydrogen phosphate (PubChem CID 172846908) has the molecular formula H5N2O6P
and a molecular weight of 160.02 g/mol. Its IUPAC name is azane;nitro dihydrogen phosphate.
Molecular Properties
| Compound Name | azane;nitro dihydrogen phosphate |
| PubChem CID | 172846908 |
| Molecular Formula | H5N2O6P |
| Molecular Weight | 160.02 g/mol |
| Exact Mass | 159.99 |
| IUPAC Name | azane;nitro dihydrogen phosphate |
| SMILES | N.O=[N+]([O-])OP(=O)(O)O |
| InChI | InChI=1S/H2NO6P.H3N/c2-1(3)7-8(4,5)6;/h(H2,4,5,6);1H3 |
| InChIKey | XNWJKJOEHGCJDA-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 144.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.02 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;nitro dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;nitro dihydrogen phosphate?
The IUPAC name of azane;nitro dihydrogen phosphate (CID 172846908) is azane;nitro dihydrogen phosphate.
What is the SMILES notation for azane;nitro dihydrogen phosphate?
The canonical SMILES for azane;nitro dihydrogen phosphate is N.O=[N+]([O-])OP(=O)(O)O.
What is the InChIKey of azane;nitro dihydrogen phosphate?
The InChIKey is XNWJKJOEHGCJDA-UHFFFAOYSA-N. The full InChI is InChI=1S/H2NO6P.H3N/c2-1(3)7-8(4,5)6;/h(H2,4,5,6);1H3.
What are the key properties of azane;nitro dihydrogen phosphate?
azane;nitro dihydrogen phosphate has a molecular weight of 160.02 g/mol, XLogP of -0.55, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;nitro dihydrogen phosphate is sourced from PubChem (CID 172846908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).