About 2-bromo-2-nitropropan-1-ol;hydroperoxymethane
2-bromo-2-nitropropan-1-ol;hydroperoxymethane (PubChem CID 174687508) has the molecular formula C4H10BrNO5
and a molecular weight of 232.03 g/mol. Its IUPAC name is 2-bromo-2-nitropropan-1-ol;hydroperoxymethane.
Molecular Properties
| Compound Name | 2-bromo-2-nitropropan-1-ol;hydroperoxymethane |
| PubChem CID | 174687508 |
| Molecular Formula | C4H10BrNO5 |
| Molecular Weight | 232.03 g/mol |
| Exact Mass | 230.97 |
| IUPAC Name | 2-bromo-2-nitropropan-1-ol;hydroperoxymethane |
| SMILES | CC(Br)(CO)[N+](=O)[O-].COO |
| InChI | InChI=1S/C3H6BrNO3.CH4O2/c1-3(4,2-6)5(7)8;1-3-2/h6H,2H2,1H3;2H,1H3 |
| InChIKey | VSDCBTINNHSLDZ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.03 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2-nitropropan-1-ol;hydroperoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2-nitropropan-1-ol;hydroperoxymethane?
The IUPAC name of 2-bromo-2-nitropropan-1-ol;hydroperoxymethane (CID 174687508) is 2-bromo-2-nitropropan-1-ol;hydroperoxymethane.
What is the SMILES notation for 2-bromo-2-nitropropan-1-ol;hydroperoxymethane?
The canonical SMILES for 2-bromo-2-nitropropan-1-ol;hydroperoxymethane is CC(Br)(CO)[N+](=O)[O-].COO.
What is the InChIKey of 2-bromo-2-nitropropan-1-ol;hydroperoxymethane?
The InChIKey is VSDCBTINNHSLDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6BrNO3.CH4O2/c1-3(4,2-6)5(7)8;1-3-2/h6H,2H2,1H3;2H,1H3.
What are the key properties of 2-bromo-2-nitropropan-1-ol;hydroperoxymethane?
2-bromo-2-nitropropan-1-ol;hydroperoxymethane has a molecular weight of 232.03 g/mol, XLogP of 0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2-nitropropan-1-ol;hydroperoxymethane is sourced from PubChem (CID 174687508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).