C6H11F6NO10S2 — CID 86663656
2-methyl-2-nitropropane-1,3-diol;bis(trifluoromethanesulfonic acid) (PubChem CID 86663656) has the molecular formula C6H11F6NO10S2 and a molecular weight of 435.27 g/mol. Its IUPAC name is 2-methyl-2-nitropropane-1,3-diol;bis(trifluoromethanesulfonic acid).
| Compound Name | 2-methyl-2-nitropropane-1,3-diol;bis(trifluoromethanesulfonic acid) |
|---|---|
| PubChem CID | 86663656 |
| Molecular Formula | C6H11F6NO10S2 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.97 |
| IUPAC Name | 2-methyl-2-nitropropane-1,3-diol;bis(trifluoromethanesulfonic acid) |
| SMILES | CC(CO)(CO)[N+](=O)[O-].O=S(=O)(O)C(F)(F)F.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C4H9NO4.2CHF3O3S/c1-4(2-6,3-7)5(8)9;2*2-1(3,4)8(5,6)7/h6-7H,2-3H2,1H3;2*(H,5,6,7) |
| InChIKey | DWBZSYMFWFGRAQ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 192.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|