C10H16F6N2O12S2 — CID 160602349
2-methyl-2-nitropropane-1,3-diol;[2-methyl-2-nitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate (PubChem CID 160602349) has the molecular formula C10H16F6N2O12S2 and a molecular weight of 534.36 g/mol. Its IUPAC name is 2-methyl-2-nitropropane-1,3-diol;[2-methyl-2-nitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate.
| Compound Name | 2-methyl-2-nitropropane-1,3-diol;[2-methyl-2-nitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 160602349 |
| Molecular Formula | C10H16F6N2O12S2 |
| Molecular Weight | 534.36 g/mol |
| Exact Mass | 534.00 |
| IUPAC Name | 2-methyl-2-nitropropane-1,3-diol;[2-methyl-2-nitro-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate |
| SMILES | CC(CO)(CO)[N+](=O)[O-].CC(COS(=O)(=O)C(F)(F)F)(COS(=O)(=O)C(F)(F)F)[N+](=O)[O-] |
| InChI | InChI=1S/C6H7F6NO8S2.C4H9NO4/c1-4(13(14)15,2-20-22(16,17)5(7,8)9)3-21-23(18,19)6(10,11)12;1-4(2-6,3-7)5(8)9/h2-3H2,1H3;6-7H,2-3H2,1H3 |
| InChIKey | RELFGKZCINNYKU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 213.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.36 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|