About 5-bromo-5-nitrohex-1-ene
5-bromo-5-nitrohex-1-ene (PubChem CID 15049513) has the molecular formula C6H10BrNO2
and a molecular weight of 208.05 g/mol. Its IUPAC name is 5-bromo-5-nitrohex-1-ene.
Molecular Properties
| Compound Name | 5-bromo-5-nitrohex-1-ene |
| PubChem CID | 15049513 |
| Molecular Formula | C6H10BrNO2 |
| Molecular Weight | 208.05 g/mol |
| Exact Mass | 206.99 |
| IUPAC Name | 5-bromo-5-nitrohex-1-ene |
| SMILES | C=CCCC(C)(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C6H10BrNO2/c1-3-4-5-6(2,7)8(9)10/h3H,1,4-5H2,2H3 |
| InChIKey | FMGHJEBMCSQHAZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.05 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-5-nitrohex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-5-nitrohex-1-ene?
The IUPAC name of 5-bromo-5-nitrohex-1-ene (CID 15049513) is 5-bromo-5-nitrohex-1-ene.
What is the SMILES notation for 5-bromo-5-nitrohex-1-ene?
The canonical SMILES for 5-bromo-5-nitrohex-1-ene is C=CCCC(C)(Br)[N+](=O)[O-].
What is the InChIKey of 5-bromo-5-nitrohex-1-ene?
The InChIKey is FMGHJEBMCSQHAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10BrNO2/c1-3-4-5-6(2,7)8(9)10/h3H,1,4-5H2,2H3.
What are the key properties of 5-bromo-5-nitrohex-1-ene?
5-bromo-5-nitrohex-1-ene has a molecular weight of 208.05 g/mol, XLogP of 2.34, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-5-nitrohex-1-ene is sourced from PubChem (CID 15049513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).