C11H19NO2 — CID 102590751
(6E)-4-methyl-4-nitrodeca-1,6-diene (PubChem CID 102590751) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (6E)-4-methyl-4-nitrodeca-1,6-diene.
| Compound Name | (6E)-4-methyl-4-nitrodeca-1,6-diene |
|---|---|
| PubChem CID | 102590751 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (6E)-4-methyl-4-nitrodeca-1,6-diene |
| SMILES | C=CCC(C)(C/C=C/CCC)[N+](=O)[O-] |
| InChI | InChI=1S/C11H19NO2/c1-4-6-7-8-10-11(3,9-5-2)12(13)14/h5,7-8H,2,4,6,9-10H2,1,3H3/b8-7+ |
| InChIKey | OQPUBJVXIDBMLO-BQYQJAHWSA-N |
| XLogP | 3.34 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|