C20H48Br6N6O17 — CID 159511458
acetaldehyde;bis(2-bromo-2-nitropropan-1-ol);1,1-dibromo-1-nitroethane;2,2-dibromo-2-nitroethanol;methane;nitromethane (PubChem CID 159511458) has the molecular formula C20H48Br6N6O17 and a molecular weight of 1124.05 g/mol. Its IUPAC name is acetaldehyde;bis(2-bromo-2-nitropropan-1-ol);1,1-dibromo-1-nitroethane;2,2-dibromo-2-nitroethanol;methane;nitromethane.
| Compound Name | acetaldehyde;bis(2-bromo-2-nitropropan-1-ol);1,1-dibromo-1-nitroethane;2,2-dibromo-2-nitroethanol;methane;nitromethane |
|---|---|
| PubChem CID | 159511458 |
| Molecular Formula | C20H48Br6N6O17 |
| Molecular Weight | 1124.05 g/mol |
| Exact Mass | 1117.82 |
| IUPAC Name | acetaldehyde;bis(2-bromo-2-nitropropan-1-ol);1,1-dibromo-1-nitroethane;2,2-dibromo-2-nitroethanol;methane;nitromethane |
| SMILES | C.C.C.C.CC(Br)(Br)[N+](=O)[O-].CC(Br)(CO)[N+](=O)[O-].CC(Br)(CO)[N+](=O)[O-].CC=O.CC=O.C[N+](=O)[O-].C[N+](=O)[O-].O=[N+]([O-])C(Br)(Br)CO |
| InChI | InChI=1S/2C3H6BrNO3.C2H3Br2NO3.C2H3Br2NO2.2C2H4O.2CH3NO2.4CH4/c2*1-3(4,2-6)5(7)8;3-2(4,1-6)5(7)8;1-2(3,4)5(6)7;2*1-2-3;2*1-2(3)4;;;;/h2*6H,2H2,1H3;6H,1H2;1H3;2*2H,1H3;2*1H3;4*1H4 |
| InChIKey | MAQRDGGKBDYKKK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 353.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1124.05 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|