About methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol
methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol (PubChem CID 91093403) has the molecular formula C15H34N2O10S2
and a molecular weight of 466.58 g/mol. Its IUPAC name is methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol.
Molecular Properties
| Compound Name | methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol |
| PubChem CID | 91093403 |
| Molecular Formula | C15H34N2O10S2 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol |
| SMILES | CC(C)(CCCO)[N+](=O)[O-].COS(=O)OCCCC(C)(C)[N+](=O)[O-].COS(C)=O |
| InChI | InChI=1S/C7H15NO5S.C6H13NO3.C2H6O2S/c1-7(2,8(9)10)5-4-6-13-14(11)12-3;1-6(2,7(9)10)4-3-5-8;1-4-5(2)3/h4-6H2,1-3H3;8H,3-5H2,1-2H3;1-2H3 |
| InChIKey | VLMPWTRXQRHVMM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 168.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol?
The IUPAC name of methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol (CID 91093403) is methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol.
What is the SMILES notation for methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol?
The canonical SMILES for methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol is CC(C)(CCCO)[N+](=O)[O-].COS(=O)OCCCC(C)(C)[N+](=O)[O-].COS(C)=O.
What is the InChIKey of methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol?
The InChIKey is VLMPWTRXQRHVMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO5S.C6H13NO3.C2H6O2S/c1-7(2,8(9)10)5-4-6-13-14(11)12-3;1-6(2,7(9)10)4-3-5-8;1-4-5(2)3/h4-6H2,1-3H3;8H,3-5H2,1-2H3;1-2H3.
What are the key properties of methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol?
methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol has a molecular weight of 466.58 g/mol, XLogP of 1.80, 12 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for methyl methanesulfinate;methyl (4-methyl-4-nitropentyl) sulfite;4-methyl-4-nitropentan-1-ol is sourced from PubChem (CID 91093403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).