About 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one
4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one (PubChem CID 91237665) has the molecular formula C9H15N3O4
and a molecular weight of 229.24 g/mol. Its IUPAC name is 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one |
| PubChem CID | 91237665 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one |
| SMILES | CC(C)(CCCc1[nH]c(=O)[nH]c1O)[N+](=O)[O-] |
| InChI | InChI=1S/C9H15N3O4/c1-9(2,12(15)16)5-3-4-6-7(13)11-8(14)10-6/h13H,3-5H2,1-2H3,(H2,10,11,14) |
| InChIKey | LOCWARIMDMVXJS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one?
The IUPAC name of 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one (CID 91237665) is 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one.
What is the SMILES notation for 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one?
The canonical SMILES for 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one is CC(C)(CCCc1[nH]c(=O)[nH]c1O)[N+](=O)[O-].
What is the InChIKey of 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one?
The InChIKey is LOCWARIMDMVXJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O4/c1-9(2,12(15)16)5-3-4-6-7(13)11-8(14)10-6/h13H,3-5H2,1-2H3,(H2,10,11,14).
What are the key properties of 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one?
4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one has a molecular weight of 229.24 g/mol, XLogP of 0.79, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one is sourced from PubChem (CID 91237665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).