C9H15N3O4 — CID 91237665
4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one (PubChem CID 91237665) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one.
| Compound Name | 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 91237665 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 4-hydroxy-5-(4-methyl-4-nitropentyl)-1,3-dihydroimidazol-2-one |
| SMILES | CC(C)(CCCc1[nH]c(=O)[nH]c1O)[N+](=O)[O-] |
| InChI | InChI=1S/C9H15N3O4/c1-9(2,12(15)16)5-3-4-6-7(13)11-8(14)10-6/h13H,3-5H2,1-2H3,(H2,10,11,14) |
| InChIKey | LOCWARIMDMVXJS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|