C14H26N2O2 — CID 54149435
4-hydroxy-5-undecyl-1,3-dihydroimidazol-2-one (PubChem CID 54149435) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 4-hydroxy-5-undecyl-1,3-dihydroimidazol-2-one.
| Compound Name | 4-hydroxy-5-undecyl-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 54149435 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 4-hydroxy-5-undecyl-1,3-dihydroimidazol-2-one |
| SMILES | CCCCCCCCCCCc1[nH]c(=O)[nH]c1O |
| InChI | InChI=1S/C14H26N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(17)16-14(18)15-12/h17H,2-11H2,1H3,(H2,15,16,18) |
| InChIKey | OGRZMAVZZHQIJZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|