C10H15ClN2O2 — CID 23648511
6-chloro-5-hexyl-1H-pyrimidine-2,4-dione (PubChem CID 23648511) has the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. Its IUPAC name is 6-chloro-5-hexyl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-chloro-5-hexyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23648511 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 6-chloro-5-hexyl-1H-pyrimidine-2,4-dione |
| SMILES | CCCCCCc1c(Cl)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15ClN2O2/c1-2-3-4-5-6-7-8(11)12-10(15)13-9(7)14/h2-6H2,1H3,(H2,12,13,14,15) |
| InChIKey | KRFZZHACLHGMCH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|