C19H35NOS — CID 141215517
4,5-dioctyl-1,2-thiazol-3-one (PubChem CID 141215517) has the molecular formula C19H35NOS and a molecular weight of 325.56 g/mol. Its IUPAC name is 4,5-dioctyl-1,2-thiazol-3-one.
| Compound Name | 4,5-dioctyl-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 141215517 |
| Molecular Formula | C19H35NOS |
| Molecular Weight | 325.56 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 4,5-dioctyl-1,2-thiazol-3-one |
| SMILES | CCCCCCCCc1s[nH]c(=O)c1CCCCCCCC |
| InChI | InChI=1S/C19H35NOS/c1-3-5-7-9-11-13-15-17-18(22-20-19(17)21)16-14-12-10-8-6-4-2/h3-16H2,1-2H3,(H,20,21) |
| InChIKey | AOUHFEIUEQRKFF-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|