C13H23NO2 — CID 10105083
2,5-dimethyl-4-octyl-1,2-oxazol-3-one (PubChem CID 10105083) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 2,5-dimethyl-4-octyl-1,2-oxazol-3-one.
| Compound Name | 2,5-dimethyl-4-octyl-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 10105083 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 2,5-dimethyl-4-octyl-1,2-oxazol-3-one |
| SMILES | CCCCCCCCc1c(C)on(C)c1=O |
| InChI | InChI=1S/C13H23NO2/c1-4-5-6-7-8-9-10-12-11(2)16-14(3)13(12)15/h4-10H2,1-3H3 |
| InChIKey | QTVMIJQMDDWWTD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|