C17H24N2O — CID 10516343
4-octyl-5-phenyl-1,2-dihydropyrazol-3-one (PubChem CID 10516343) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-octyl-5-phenyl-1,2-dihydropyrazol-3-one.
| Compound Name | 4-octyl-5-phenyl-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 10516343 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 4-octyl-5-phenyl-1,2-dihydropyrazol-3-one |
| SMILES | CCCCCCCCc1c(-c2ccccc2)[nH][nH]c1=O |
| InChI | InChI=1S/C17H24N2O/c1-2-3-4-5-6-10-13-15-16(18-19-17(15)20)14-11-8-7-9-12-14/h7-9,11-12H,2-6,10,13H2,1H3,(H2,18,19,20) |
| InChIKey | IMDFHFLLVCOZAA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|