C9H16N2O — CID 13478903
4-methyl-5-pentyl-1,3-dihydroimidazol-2-one (PubChem CID 13478903) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 4-methyl-5-pentyl-1,3-dihydroimidazol-2-one.
| Compound Name | 4-methyl-5-pentyl-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 13478903 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 4-methyl-5-pentyl-1,3-dihydroimidazol-2-one |
| SMILES | CCCCCc1[nH]c(=O)[nH]c1C |
| InChI | InChI=1S/C9H16N2O/c1-3-4-5-6-8-7(2)10-9(12)11-8/h3-6H2,1-2H3,(H2,10,11,12) |
| InChIKey | BQSBGTBNUSFIFV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|