C19H39N4O3+ — CID 66977649
tetrabutylazanium;1,3,5-triazinane-2,4,6-trione (PubChem CID 66977649) has the molecular formula C19H39N4O3+ and a molecular weight of 371.55 g/mol. Its IUPAC name is tetrabutylazanium;1,3,5-triazinane-2,4,6-trione.
| Compound Name | tetrabutylazanium;1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 66977649 |
| Molecular Formula | C19H39N4O3+ |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | tetrabutylazanium;1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=c1[nH]c(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C16H36N.C3H3N3O3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-1-4-2(8)6-3(9)5-1/h5-16H2,1-4H3;(H3,4,5,6,7,8,9)/q+1; |
| InChIKey | BXSBFONFZVIACR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|