C22H41NO — CID 141227855
3,4,5-trihexyl-1H-pyrrol-2-ol (PubChem CID 141227855) has the molecular formula C22H41NO and a molecular weight of 335.58 g/mol. Its IUPAC name is 3,4,5-trihexyl-1H-pyrrol-2-ol.
| Compound Name | 3,4,5-trihexyl-1H-pyrrol-2-ol |
|---|---|
| PubChem CID | 141227855 |
| Molecular Formula | C22H41NO |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.32 |
| IUPAC Name | 3,4,5-trihexyl-1H-pyrrol-2-ol |
| SMILES | CCCCCCc1[nH]c(O)c(CCCCCC)c1CCCCCC |
| InChI | InChI=1S/C22H41NO/c1-4-7-10-13-16-19-20(17-14-11-8-5-2)22(24)23-21(19)18-15-12-9-6-3/h23-24H,4-18H2,1-3H3 |
| InChIKey | LUVBWAGCLNPILU-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|