C16H27NO — CID 175267375
5,6-dibutyl-4-ethyl-3-methyl-1H-pyridin-2-one (PubChem CID 175267375) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 5,6-dibutyl-4-ethyl-3-methyl-1H-pyridin-2-one.
| Compound Name | 5,6-dibutyl-4-ethyl-3-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 175267375 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 5,6-dibutyl-4-ethyl-3-methyl-1H-pyridin-2-one |
| SMILES | CCCCc1[nH]c(=O)c(C)c(CC)c1CCCC |
| InChI | InChI=1S/C16H27NO/c1-5-8-10-14-13(7-3)12(4)16(18)17-15(14)11-9-6-2/h5-11H2,1-4H3,(H,17,18) |
| InChIKey | RTJCVDOEEZRGEL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |