C18H25NO2 — CID 166603958
5,6,7,8-tetradeuterio-3-hydroxy-2-nonyl-1H-quinolin-4-one (PubChem CID 166603958) has the molecular formula C18H25NO2 and a molecular weight of 291.43 g/mol. Its IUPAC name is 5,6,7,8-tetradeuterio-3-hydroxy-2-nonyl-1H-quinolin-4-one.
| Compound Name | 5,6,7,8-tetradeuterio-3-hydroxy-2-nonyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 166603958 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 5,6,7,8-tetradeuterio-3-hydroxy-2-nonyl-1H-quinolin-4-one |
| SMILES | [2H]c1c([2H])c([2H])c2c(=O)c(O)c(CCCCCCCCC)[nH]c2c1[2H] |
| InChI | InChI=1S/C18H25NO2/c1-2-3-4-5-6-7-8-13-16-18(21)17(20)14-11-9-10-12-15(14)19-16/h9-12,21H,2-8,13H2,1H3,(H,19,20)/i9D,10D,11D,12D |
| InChIKey | IQZSNBAQPVKMLG-IRYCTXJYSA-N |
| XLogP | 4.53 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|