About 4-deuterio-2-nonylphenol
4-deuterio-2-nonylphenol (PubChem CID 175937184) has the molecular formula C15H24O
and a molecular weight of 221.36 g/mol. Its IUPAC name is 4-deuterio-2-nonylphenol.
Molecular Properties
| Compound Name | 4-deuterio-2-nonylphenol |
| PubChem CID | 175937184 |
| Molecular Formula | C15H24O |
| Molecular Weight | 221.36 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 4-deuterio-2-nonylphenol |
| SMILES | [2H]c1ccc(O)c(CCCCCCCCC)c1 |
| InChI | InChI=1S/C15H24O/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16/h9-10,12-13,16H,2-8,11H2,1H3/i9D |
| InChIKey | SNQQPOLDUKLAAF-QOWOAITPSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-deuterio-2-nonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-deuterio-2-nonylphenol?
The IUPAC name of 4-deuterio-2-nonylphenol (CID 175937184) is 4-deuterio-2-nonylphenol.
What is the SMILES notation for 4-deuterio-2-nonylphenol?
The canonical SMILES for 4-deuterio-2-nonylphenol is [2H]c1ccc(O)c(CCCCCCCCC)c1.
What is the InChIKey of 4-deuterio-2-nonylphenol?
The InChIKey is SNQQPOLDUKLAAF-QOWOAITPSA-N. The full InChI is InChI=1S/C15H24O/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16/h9-10,12-13,16H,2-8,11H2,1H3/i9D.
What are the key properties of 4-deuterio-2-nonylphenol?
4-deuterio-2-nonylphenol has a molecular weight of 221.36 g/mol, XLogP of 4.69, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-deuterio-2-nonylphenol is sourced from PubChem (CID 175937184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).