C8H12N2O5S — CID 54522737
5-butylsulfonyl-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 54522737) has the molecular formula C8H12N2O5S and a molecular weight of 248.26 g/mol. Its IUPAC name is 5-butylsulfonyl-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-butylsulfonyl-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54522737 |
| Molecular Formula | C8H12N2O5S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 5-butylsulfonyl-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | CCCCS(=O)(=O)c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H12N2O5S/c1-2-3-4-16(14,15)5-6(11)9-8(13)10-7(5)12/h2-4H2,1H3,(H3,9,10,11,12,13) |
| InChIKey | YQZDTCFODGWNHR-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |