C13H20N4O4 — CID 135493370
N-[(E)-1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]heptanamide (PubChem CID 135493370) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[(E)-1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]heptanamide.
| Compound Name | N-[(E)-1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]heptanamide |
|---|---|
| PubChem CID | 135493370 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-[(E)-1-(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)ethylideneamino]heptanamide |
| SMILES | CCCCCCC(=O)N/N=C(\C)c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H20N4O4/c1-3-4-5-6-7-9(18)17-16-8(2)10-11(19)14-13(21)15-12(10)20/h3-7H2,1-2H3,(H,17,18)(H3,14,15,19,20,21)/b16-8+ |
| InChIKey | LLHQADWFSCSDAV-LZYBPNLTSA-N |
| XLogP | 0.58 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|