C7H13N3O2 — CID 54058151
4-(4-aminobutyl)-5-hydroxy-1,3-dihydroimidazol-2-one (PubChem CID 54058151) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is 4-(4-aminobutyl)-5-hydroxy-1,3-dihydroimidazol-2-one.
| Compound Name | 4-(4-aminobutyl)-5-hydroxy-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 54058151 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 4-(4-aminobutyl)-5-hydroxy-1,3-dihydroimidazol-2-one |
| SMILES | NCCCCc1[nH]c(=O)[nH]c1O |
| InChI | InChI=1S/C7H13N3O2/c8-4-2-1-3-5-6(11)10-7(12)9-5/h11H,1-4,8H2,(H2,9,10,12) |
| InChIKey | LXSXLDSPGAPJRX-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|