C5H7FN4O9 — CID 119097098
1-(2-fluoro-2,2-dinitroethoxy)-2,2-dinitropropane (PubChem CID 119097098) has the molecular formula C5H7FN4O9 and a molecular weight of 286.13 g/mol. Its IUPAC name is 1-(2-fluoro-2,2-dinitroethoxy)-2,2-dinitropropane.
| Compound Name | 1-(2-fluoro-2,2-dinitroethoxy)-2,2-dinitropropane |
|---|---|
| PubChem CID | 119097098 |
| Molecular Formula | C5H7FN4O9 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 1-(2-fluoro-2,2-dinitroethoxy)-2,2-dinitropropane |
| SMILES | CC(COCC(F)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H7FN4O9/c1-4(7(11)12,8(13)14)2-19-3-5(6,9(15)16)10(17)18/h2-3H2,1H3 |
| InChIKey | PQBLRSUXCYUKKZ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 181.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|