C3H4ClFN2O5 — CID 12507561
2-(chloromethoxy)-1-fluoro-1,1-dinitroethane (PubChem CID 12507561) has the molecular formula C3H4ClFN2O5 and a molecular weight of 202.52 g/mol. Its IUPAC name is 2-(chloromethoxy)-1-fluoro-1,1-dinitroethane.
| Compound Name | 2-(chloromethoxy)-1-fluoro-1,1-dinitroethane |
|---|---|
| PubChem CID | 12507561 |
| Molecular Formula | C3H4ClFN2O5 |
| Molecular Weight | 202.52 g/mol |
| Exact Mass | 201.98 |
| IUPAC Name | 2-(chloromethoxy)-1-fluoro-1,1-dinitroethane |
| SMILES | O=[N+]([O-])C(F)(COCCl)[N+](=O)[O-] |
| InChI | InChI=1S/C3H4ClFN2O5/c4-2-12-1-3(5,6(8)9)7(10)11/h1-2H2 |
| InChIKey | NNMJNYBJPWONAH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.52 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|