C5H5Br2FN2O5 — CID 119097105
(Z)-1,2-dibromo-3-(2-fluoro-2,2-dinitroethoxy)prop-1-ene (PubChem CID 119097105) has the molecular formula C5H5Br2FN2O5 and a molecular weight of 351.91 g/mol. Its IUPAC name is (Z)-1,2-dibromo-3-(2-fluoro-2,2-dinitroethoxy)prop-1-ene.
| Compound Name | (Z)-1,2-dibromo-3-(2-fluoro-2,2-dinitroethoxy)prop-1-ene |
|---|---|
| PubChem CID | 119097105 |
| Molecular Formula | C5H5Br2FN2O5 |
| Molecular Weight | 351.91 g/mol |
| Exact Mass | 349.85 |
| IUPAC Name | (Z)-1,2-dibromo-3-(2-fluoro-2,2-dinitroethoxy)prop-1-ene |
| SMILES | O=[N+]([O-])C(F)(COC/C(Br)=C/Br)[N+](=O)[O-] |
| InChI | InChI=1S/C5H5Br2FN2O5/c6-1-4(7)2-15-3-5(8,9(11)12)10(13)14/h1H,2-3H2/b4-1- |
| InChIKey | JBTMVTDVZHPWLJ-RJRFIUFISA-N |
| XLogP | 1.81 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.91 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|