C6H4F8N2O6 — CID 139201473
(2,2,3,3,4,4,5,5-octafluoro-6-nitrooxyhexyl) nitrate (PubChem CID 139201473) has the molecular formula C6H4F8N2O6 and a molecular weight of 352.09 g/mol. Its IUPAC name is (2,2,3,3,4,4,5,5-octafluoro-6-nitrooxyhexyl) nitrate.
| Compound Name | (2,2,3,3,4,4,5,5-octafluoro-6-nitrooxyhexyl) nitrate |
|---|---|
| PubChem CID | 139201473 |
| Molecular Formula | C6H4F8N2O6 |
| Molecular Weight | 352.09 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | (2,2,3,3,4,4,5,5-octafluoro-6-nitrooxyhexyl) nitrate |
| SMILES | O=[N+]([O-])OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CO[N+](=O)[O-] |
| InChI | InChI=1S/C6H4F8N2O6/c7-3(8,1-21-15(17)18)5(11,12)6(13,14)4(9,10)2-22-16(19)20/h1-2H2 |
| InChIKey | MOJZFXHVORVHFF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.09 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|