3,3,4,4,5,5,5-heptafluoropentyl nitrate

C5H4F7NO3 — CID 154190196

IUPAC3,3,4,4,5,5,5-heptafluoropentyl nitrate
SMILESO=[N+]([O-])OCCC(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C5H4F7NO3/c6-3(7,1-2-16-13(14)15)4(8,9)5(10,11)12/h1-2H2
InChIKeyJYWPSYCBCVGNQG-UHFFFAOYSA-N
MW259.08 g/mol
LogP2.42
Rot. Bonds5

About 3,3,4,4,5,5,5-heptafluoropentyl nitrate

3,3,4,4,5,5,5-heptafluoropentyl nitrate (PubChem CID 154190196) has the molecular formula C5H4F7NO3 and a molecular weight of 259.08 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoropentyl nitrate.

Molecular Properties

Compound Name3,3,4,4,5,5,5-heptafluoropentyl nitrate
PubChem CID154190196
Molecular FormulaC5H4F7NO3
Molecular Weight259.08 g/mol
Exact Mass259.01
IUPAC Name3,3,4,4,5,5,5-heptafluoropentyl nitrate
SMILESO=[N+]([O-])OCCC(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C5H4F7NO3/c6-3(7,1-2-16-13(14)15)4(8,9)5(10,11)12/h1-2H2
InChIKeyJYWPSYCBCVGNQG-UHFFFAOYSA-N
XLogP2.42
TPSA52.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.08
LogP ≤ 52.42
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 3,3,4,4,5,5,5-heptafluoropentyl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3,4,4,5,5,5-heptafluoropentyl nitrate?
The IUPAC name of 3,3,4,4,5,5,5-heptafluoropentyl nitrate (CID 154190196) is 3,3,4,4,5,5,5-heptafluoropentyl nitrate.
What is the SMILES notation for 3,3,4,4,5,5,5-heptafluoropentyl nitrate?
The canonical SMILES for 3,3,4,4,5,5,5-heptafluoropentyl nitrate is O=[N+]([O-])OCCC(F)(F)C(F)(F)C(F)(F)F.
What is the InChIKey of 3,3,4,4,5,5,5-heptafluoropentyl nitrate?
The InChIKey is JYWPSYCBCVGNQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F7NO3/c6-3(7,1-2-16-13(14)15)4(8,9)5(10,11)12/h1-2H2.
What are the key properties of 3,3,4,4,5,5,5-heptafluoropentyl nitrate?
3,3,4,4,5,5,5-heptafluoropentyl nitrate has a molecular weight of 259.08 g/mol, XLogP of 2.42, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,4,4,5,5,5-heptafluoropentyl nitrate is sourced from PubChem (CID 154190196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).