C5H4F7NO3 — CID 154190196
3,3,4,4,5,5,5-heptafluoropentyl nitrate (PubChem CID 154190196) has the molecular formula C5H4F7NO3 and a molecular weight of 259.08 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoropentyl nitrate.
| Compound Name | 3,3,4,4,5,5,5-heptafluoropentyl nitrate |
|---|---|
| PubChem CID | 154190196 |
| Molecular Formula | C5H4F7NO3 |
| Molecular Weight | 259.08 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 3,3,4,4,5,5,5-heptafluoropentyl nitrate |
| SMILES | O=[N+]([O-])OCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H4F7NO3/c6-3(7,1-2-16-13(14)15)4(8,9)5(10,11)12/h1-2H2 |
| InChIKey | JYWPSYCBCVGNQG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.08 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|