C10H16N7O17+ — CID 90285497
bis[2,2-bis(nitromethyl)-3-nitrooxypropoxy]-oxoazanium (PubChem CID 90285497) has the molecular formula C10H16N7O17+ and a molecular weight of 506.27 g/mol. Its IUPAC name is bis[2,2-bis(nitromethyl)-3-nitrooxypropoxy]-oxoazanium.
| Compound Name | bis[2,2-bis(nitromethyl)-3-nitrooxypropoxy]-oxoazanium |
|---|---|
| PubChem CID | 90285497 |
| Molecular Formula | C10H16N7O17+ |
| Molecular Weight | 506.27 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | bis[2,2-bis(nitromethyl)-3-nitrooxypropoxy]-oxoazanium |
| SMILES | O=[N+]([O-])CC(CO[N+](=O)[O-])(CO[N+](=O)OCC(CO[N+](=O)[O-])(C[N+](=O)[O-])C[N+](=O)[O-])C[N+](=O)[O-] |
| InChI | InChI=1S/C10H16N7O17/c18-11(19)1-9(2-12(20)21,5-31-15(26)27)7-33-17(30)34-8-10(3-13(22)23,4-14(24)25)6-32-16(28)29/h1-8H2/q+1 |
| InChIKey | WTUALGBFKXPZQP-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 315.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.27 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|