C3H3F2NO4 — CID 87346601
2,2-difluoro-3-nitropropanoic acid (PubChem CID 87346601) has the molecular formula C3H3F2NO4 and a molecular weight of 155.06 g/mol. Its IUPAC name is 2,2-difluoro-3-nitropropanoic acid.
| Compound Name | 2,2-difluoro-3-nitropropanoic acid |
|---|---|
| PubChem CID | 87346601 |
| Molecular Formula | C3H3F2NO4 |
| Molecular Weight | 155.06 g/mol |
| Exact Mass | 155.00 |
| IUPAC Name | 2,2-difluoro-3-nitropropanoic acid |
| SMILES | O=C(O)C(F)(F)C[N+](=O)[O-] |
| InChI | InChI=1S/C3H3F2NO4/c4-3(5,2(7)8)1-6(9)10/h1H2,(H,7,8) |
| InChIKey | ICNLBLJTPHEQIK-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.06 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|