C3H5N3O9 — CID 141229840
2,2,3-trinitropropane-1,1,1-triol (PubChem CID 141229840) has the molecular formula C3H5N3O9 and a molecular weight of 227.08 g/mol. Its IUPAC name is 2,2,3-trinitropropane-1,1,1-triol.
| Compound Name | 2,2,3-trinitropropane-1,1,1-triol |
|---|---|
| PubChem CID | 141229840 |
| Molecular Formula | C3H5N3O9 |
| Molecular Weight | 227.08 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 2,2,3-trinitropropane-1,1,1-triol |
| SMILES | O=[N+]([O-])CC([N+](=O)[O-])([N+](=O)[O-])C(O)(O)O |
| InChI | InChI=1S/C3H5N3O9/c7-3(8,9)2(5(12)13,6(14)15)1-4(10)11/h7-9H,1H2 |
| InChIKey | CKYOJHYPOUNDJJ-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 190.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.08 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|