C6H10F3NO3 — CID 134944064
(2R)-1,1,1-trifluoro-2-(nitromethyl)pentan-2-ol (PubChem CID 134944064) has the molecular formula C6H10F3NO3 and a molecular weight of 201.14 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-2-(nitromethyl)pentan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-2-(nitromethyl)pentan-2-ol |
|---|---|
| PubChem CID | 134944064 |
| Molecular Formula | C6H10F3NO3 |
| Molecular Weight | 201.14 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | (2R)-1,1,1-trifluoro-2-(nitromethyl)pentan-2-ol |
| SMILES | CCC[C@@](O)(C[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO3/c1-2-3-5(11,4-10(12)13)6(7,8)9/h11H,2-4H2,1H3/t5-/m1/s1 |
| InChIKey | SYUKNRRYSFDDIB-RXMQYKEDSA-N |
| XLogP | 1.36 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.14 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|