C6H13NO7 — CID 174862802
2-methylpropanoic acid;2-nitroethane-1,1,1-triol (PubChem CID 174862802) has the molecular formula C6H13NO7 and a molecular weight of 211.17 g/mol. Its IUPAC name is 2-methylpropanoic acid;2-nitroethane-1,1,1-triol.
| Compound Name | 2-methylpropanoic acid;2-nitroethane-1,1,1-triol |
|---|---|
| PubChem CID | 174862802 |
| Molecular Formula | C6H13NO7 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 2-methylpropanoic acid;2-nitroethane-1,1,1-triol |
| SMILES | CC(C)C(=O)O.O=[N+]([O-])CC(O)(O)O |
| InChI | InChI=1S/C4H8O2.C2H5NO5/c1-3(2)4(5)6;4-2(5,6)1-3(7)8/h3H,1-2H3,(H,5,6);4-6H,1H2 |
| InChIKey | PKFCEAMADNJBKM-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|