C8H13NO3 — CID 135040023
1,1-dicyclopropyl-2-nitroethanol (PubChem CID 135040023) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 1,1-dicyclopropyl-2-nitroethanol.
| Compound Name | 1,1-dicyclopropyl-2-nitroethanol |
|---|---|
| PubChem CID | 135040023 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 1,1-dicyclopropyl-2-nitroethanol |
| SMILES | O=[N+]([O-])CC(O)(C1CC1)C1CC1 |
| InChI | InChI=1S/C8H13NO3/c10-8(5-9(11)12,6-1-2-6)7-3-4-7/h6-7,10H,1-5H2 |
| InChIKey | VRIMGNUCAOPJEU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|