C10H19N3O9 — CID 89376990
[4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate (PubChem CID 89376990) has the molecular formula C10H19N3O9 and a molecular weight of 325.27 g/mol. Its IUPAC name is [4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate.
| Compound Name | [4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate |
|---|---|
| PubChem CID | 89376990 |
| Molecular Formula | C10H19N3O9 |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate |
| SMILES | CCC(C)(C)CC(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-] |
| InChI | InChI=1S/C10H19N3O9/c1-4-9(2,3)5-10(6-20-11(14)15,7-21-12(16)17)8-22-13(18)19/h4-8H2,1-3H3 |
| InChIKey | LDWFQEITUCBWAD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 157.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|