[4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate

C10H19N3O9 — CID 89376990

IUPAC[4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate
SMILESCCC(C)(C)CC(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-]
InChIInChI=1S/C10H19N3O9/c1-4-9(2,3)5-10(6-20-11(14)15,7-21-12(16)17)8-22-13(18)19/h4-8H2,1-3H3
InChIKeyLDWFQEITUCBWAD-UHFFFAOYSA-N
MW325.27 g/mol
LogP1.42
Rot. Bonds12

About [4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate

[4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate (PubChem CID 89376990) has the molecular formula C10H19N3O9 and a molecular weight of 325.27 g/mol. Its IUPAC name is [4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate.

Molecular Properties

Compound Name[4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate
PubChem CID89376990
Molecular FormulaC10H19N3O9
Molecular Weight325.27 g/mol
Exact Mass325.11
IUPAC Name[4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate
SMILESCCC(C)(C)CC(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-]
InChIInChI=1S/C10H19N3O9/c1-4-9(2,3)5-10(6-20-11(14)15,7-21-12(16)17)8-22-13(18)19/h4-8H2,1-3H3
InChIKeyLDWFQEITUCBWAD-UHFFFAOYSA-N
XLogP1.42
TPSA157.11 Ų
H-Bond Donors
H-Bond Acceptors9
Rotatable Bonds12
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.27
LogP ≤ 51.42
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 109

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate?
The IUPAC name of [4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate (CID 89376990) is [4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate.
What is the SMILES notation for [4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate?
The canonical SMILES for [4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate is CCC(C)(C)CC(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-].
What is the InChIKey of [4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate?
The InChIKey is LDWFQEITUCBWAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O9/c1-4-9(2,3)5-10(6-20-11(14)15,7-21-12(16)17)8-22-13(18)19/h4-8H2,1-3H3.
What are the key properties of [4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate?
[4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate has a molecular weight of 325.27 g/mol, XLogP of 1.42, 12 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-dimethyl-2,2-bis(nitrooxymethyl)hexyl] nitrate is sourced from PubChem (CID 89376990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).