C21H43N5O13+2 — CID 90931944
(3-carboxy-2-nitrooxypropyl)-trimethylazanium;[4-[2-ethyl-2-(nitrooxymethyl)butoxy]-2-nitrooxy-4-oxobutyl]-trimethylazanium (PubChem CID 90931944) has the molecular formula C21H43N5O13+2 and a molecular weight of 573.60 g/mol. Its IUPAC name is (3-carboxy-2-nitrooxypropyl)-trimethylazanium;[4-[2-ethyl-2-(nitrooxymethyl)butoxy]-2-nitrooxy-4-oxobutyl]-trimethylazanium.
| Compound Name | (3-carboxy-2-nitrooxypropyl)-trimethylazanium;[4-[2-ethyl-2-(nitrooxymethyl)butoxy]-2-nitrooxy-4-oxobutyl]-trimethylazanium |
|---|---|
| PubChem CID | 90931944 |
| Molecular Formula | C21H43N5O13+2 |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | (3-carboxy-2-nitrooxypropyl)-trimethylazanium;[4-[2-ethyl-2-(nitrooxymethyl)butoxy]-2-nitrooxy-4-oxobutyl]-trimethylazanium |
| SMILES | CCC(CC)(COC(=O)CC(C[N+](C)(C)C)O[N+](=O)[O-])CO[N+](=O)[O-].C[N+](C)(C)CC(CC(=O)O)O[N+](=O)[O-] |
| InChI | InChI=1S/C14H28N3O8.C7H14N2O5/c1-6-14(7-2,11-24-15(19)20)10-23-13(18)8-12(25-16(21)22)9-17(3,4)5;1-9(2,3)5-6(4-7(10)11)14-8(12)13/h12H,6-11H2,1-5H3;6H,4-5H2,1-3H3/q+1;/p+1 |
| InChIKey | PHCHZYUMSYZKNA-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 220.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|