C4H7F3N2O4Si — CID 173445428
difluoro-(4-fluoro-4,4-dinitrobutyl)silane (PubChem CID 173445428) has the molecular formula C4H7F3N2O4Si and a molecular weight of 232.19 g/mol. Its IUPAC name is difluoro-(4-fluoro-4,4-dinitrobutyl)silane.
| Compound Name | difluoro-(4-fluoro-4,4-dinitrobutyl)silane |
|---|---|
| PubChem CID | 173445428 |
| Molecular Formula | C4H7F3N2O4Si |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | difluoro-(4-fluoro-4,4-dinitrobutyl)silane |
| SMILES | O=[N+]([O-])C(F)(CCC[SiH](F)F)[N+](=O)[O-] |
| InChI | InChI=1S/C4H7F3N2O4Si/c5-4(8(10)11,9(12)13)2-1-3-14(6)7/h14H,1-3H2 |
| InChIKey | CDUHMYJYYBINTB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|