C7H12FN5O8 — CID 134883336
N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrobutan-1-amine (PubChem CID 134883336) has the molecular formula C7H12FN5O8 and a molecular weight of 313.20 g/mol. Its IUPAC name is N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrobutan-1-amine.
| Compound Name | N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrobutan-1-amine |
|---|---|
| PubChem CID | 134883336 |
| Molecular Formula | C7H12FN5O8 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-(3-fluoro-3,3-dinitropropyl)-2,2-dinitrobutan-1-amine |
| SMILES | CCC(CNCCC(F)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C7H12FN5O8/c1-2-6(10(14)15,11(16)17)5-9-4-3-7(8,12(18)19)13(20)21/h9H,2-5H2,1H3 |
| InChIKey | NTRLHSGILRFVOM-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 184.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|