C7H10F2N8O12 — CID 86200191
N-(2-fluoro-2,2-dinitroethyl)-N-[3-[(2-fluoro-2,2-dinitroethyl)-nitroamino]propyl]nitramide (PubChem CID 86200191) has the molecular formula C7H10F2N8O12 and a molecular weight of 436.20 g/mol. Its IUPAC name is N-(2-fluoro-2,2-dinitroethyl)-N-[3-[(2-fluoro-2,2-dinitroethyl)-nitroamino]propyl]nitramide.
| Compound Name | N-(2-fluoro-2,2-dinitroethyl)-N-[3-[(2-fluoro-2,2-dinitroethyl)-nitroamino]propyl]nitramide |
|---|---|
| PubChem CID | 86200191 |
| Molecular Formula | C7H10F2N8O12 |
| Molecular Weight | 436.20 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | N-(2-fluoro-2,2-dinitroethyl)-N-[3-[(2-fluoro-2,2-dinitroethyl)-nitroamino]propyl]nitramide |
| SMILES | O=[N+]([O-])N(CCCN(CC(F)([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])CC(F)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C7H10F2N8O12/c8-6(12(18)19,13(20)21)4-10(16(26)27)2-1-3-11(17(28)29)5-7(9,14(22)23)15(24)25/h1-5H2 |
| InChIKey | CPHADCWQYSVKPJ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 265.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.20 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|