C7H4F7N5O10S5 — CID 88617540
1,1,2,2,2-pentakis(fluorosulfanyl)ethyl N,N-bis(2-fluoro-2,2-dinitroethyl)carbamate (PubChem CID 88617540) has the molecular formula C7H4F7N5O10S5 and a molecular weight of 611.45 g/mol. Its IUPAC name is 1,1,2,2,2-pentakis(fluorosulfanyl)ethyl N,N-bis(2-fluoro-2,2-dinitroethyl)carbamate.
| Compound Name | 1,1,2,2,2-pentakis(fluorosulfanyl)ethyl N,N-bis(2-fluoro-2,2-dinitroethyl)carbamate |
|---|---|
| PubChem CID | 88617540 |
| Molecular Formula | C7H4F7N5O10S5 |
| Molecular Weight | 611.45 g/mol |
| Exact Mass | 610.84 |
| IUPAC Name | 1,1,2,2,2-pentakis(fluorosulfanyl)ethyl N,N-bis(2-fluoro-2,2-dinitroethyl)carbamate |
| SMILES | O=C(OC(SF)(SF)C(SF)(SF)SF)N(CC(F)([N+](=O)[O-])[N+](=O)[O-])CC(F)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C7H4F7N5O10S5/c8-4(16(21)22,17(23)24)1-15(2-5(9,18(25)26)19(27)28)3(20)29-6(30-10,31-11)7(32-12,33-13)34-14/h1-2H2 |
| InChIKey | DUZKXFXVALOOLY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 202.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|