C2F5NO3 — CID 23233313
(1,1,2,2-tetrafluoro-2-nitroethyl) hypofluorite (PubChem CID 23233313) has the molecular formula C2F5NO3 and a molecular weight of 181.02 g/mol. Its IUPAC name is (1,1,2,2-tetrafluoro-2-nitroethyl) hypofluorite.
| Compound Name | (1,1,2,2-tetrafluoro-2-nitroethyl) hypofluorite |
|---|---|
| PubChem CID | 23233313 |
| Molecular Formula | C2F5NO3 |
| Molecular Weight | 181.02 g/mol |
| Exact Mass | 180.98 |
| IUPAC Name | (1,1,2,2-tetrafluoro-2-nitroethyl) hypofluorite |
| SMILES | O=[N+]([O-])C(F)(F)C(F)(F)OF |
| InChI | InChI=1S/C2F5NO3/c3-1(4,8(9)10)2(5,6)11-7 |
| InChIKey | HEODBTJMWYMALO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.02 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|