C3H3F6N3O3 — CID 23235579
1-N,1-N,1-N',1-N',2,2-hexafluoro-1-methoxy-2-nitroethane-1,1-diamine (PubChem CID 23235579) has the molecular formula C3H3F6N3O3 and a molecular weight of 243.06 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',2,2-hexafluoro-1-methoxy-2-nitroethane-1,1-diamine.
| Compound Name | 1-N,1-N,1-N',1-N',2,2-hexafluoro-1-methoxy-2-nitroethane-1,1-diamine |
|---|---|
| PubChem CID | 23235579 |
| Molecular Formula | C3H3F6N3O3 |
| Molecular Weight | 243.06 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 1-N,1-N,1-N',1-N',2,2-hexafluoro-1-methoxy-2-nitroethane-1,1-diamine |
| SMILES | COC(N(F)F)(N(F)F)C(F)(F)[N+](=O)[O-] |
| InChI | InChI=1S/C3H3F6N3O3/c1-15-3(10(6)7,11(8)9)2(4,5)12(13)14/h1H3 |
| InChIKey | GDKXIEJDJOOGKH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.06 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|