About 2-fluoro-2,2-dinitroacetaldehyde
2-fluoro-2,2-dinitroacetaldehyde (PubChem CID 88797653) has the molecular formula C2HFN2O5
and a molecular weight of 152.04 g/mol. Its IUPAC name is 2-fluoro-2,2-dinitroacetaldehyde.
Molecular Properties
| Compound Name | 2-fluoro-2,2-dinitroacetaldehyde |
| PubChem CID | 88797653 |
| Molecular Formula | C2HFN2O5 |
| Molecular Weight | 152.04 g/mol |
| Exact Mass | 151.99 |
| IUPAC Name | 2-fluoro-2,2-dinitroacetaldehyde |
| SMILES | O=CC(F)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C2HFN2O5/c3-2(1-6,4(7)8)5(9)10/h1H |
| InChIKey | PJDUXWJGZQMFHP-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.04 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-2,2-dinitroacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2,2-dinitroacetaldehyde?
The IUPAC name of 2-fluoro-2,2-dinitroacetaldehyde (CID 88797653) is 2-fluoro-2,2-dinitroacetaldehyde.
What is the SMILES notation for 2-fluoro-2,2-dinitroacetaldehyde?
The canonical SMILES for 2-fluoro-2,2-dinitroacetaldehyde is O=CC(F)([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2-fluoro-2,2-dinitroacetaldehyde?
The InChIKey is PJDUXWJGZQMFHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HFN2O5/c3-2(1-6,4(7)8)5(9)10/h1H.
What are the key properties of 2-fluoro-2,2-dinitroacetaldehyde?
2-fluoro-2,2-dinitroacetaldehyde has a molecular weight of 152.04 g/mol, XLogP of -0.64, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2,2-dinitroacetaldehyde is sourced from PubChem (CID 88797653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).